C15H18N2O3S — CID 91687694
1-[(4-methylbenzoyl)carbamothioyl]piperidine-4-carboxylic acid (PubChem CID 91687694) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[(4-methylbenzoyl)carbamothioyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(4-methylbenzoyl)carbamothioyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 91687694 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[(4-methylbenzoyl)carbamothioyl]piperidine-4-carboxylic acid |
| SMILES | Cc1ccc(C(=O)NC(=S)N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-10-2-4-11(5-3-10)13(18)16-15(21)17-8-6-12(7-9-17)14(19)20/h2-5,12H,6-9H2,1H3,(H,19,20)(H,16,18,21) |
| InChIKey | PCGBPWSUWLHVQY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|