C20H28N2O5S — CID 17231092
ethyl 1-[[4-(2-ethoxyethoxy)benzoyl]carbamothioyl]piperidine-4-carboxylate (PubChem CID 17231092) has the molecular formula C20H28N2O5S and a molecular weight of 408.52 g/mol. Its IUPAC name is ethyl 1-[[4-(2-ethoxyethoxy)benzoyl]carbamothioyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[4-(2-ethoxyethoxy)benzoyl]carbamothioyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 17231092 |
| Molecular Formula | C20H28N2O5S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | ethyl 1-[[4-(2-ethoxyethoxy)benzoyl]carbamothioyl]piperidine-4-carboxylate |
| SMILES | CCOCCOc1ccc(C(=O)NC(=S)N2CCC(C(=O)OCC)CC2)cc1 |
| InChI | InChI=1S/C20H28N2O5S/c1-3-25-13-14-27-17-7-5-15(6-8-17)18(23)21-20(28)22-11-9-16(10-12-22)19(24)26-4-2/h5-8,16H,3-4,9-14H2,1-2H3,(H,21,23,28) |
| InChIKey | JQIFJLLVRJLLCU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|