C17H17Cl3N4S — CID 3807205
N-(2-chloro-4-methylphenyl)-4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbothioamide (PubChem CID 3807205) has the molecular formula C17H17Cl3N4S and a molecular weight of 415.78 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbothioamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3807205 |
| Molecular Formula | C17H17Cl3N4S |
| Molecular Weight | 415.78 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-4-(3,5-dichloro-4-pyridinyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(c3c(Cl)cncc3Cl)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl3N4S/c1-11-2-3-15(12(18)8-11)22-17(25)24-6-4-23(5-7-24)16-13(19)9-21-10-14(16)20/h2-3,8-10H,4-7H2,1H3,(H,22,25) |
| InChIKey | ZIHZOVMJBDZEAP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.78 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|