About 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide
4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide (PubChem CID 20787689) has the molecular formula C17H16Cl3N3S
and a molecular weight of 400.76 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide.
Molecular Properties
| Compound Name | 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide |
| PubChem CID | 20787689 |
| Molecular Formula | C17H16Cl3N3S |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)cc1Cl)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H16Cl3N3S/c18-12-5-6-15(14(20)11-12)21-17(24)23-9-7-22(8-10-23)16-4-2-1-3-13(16)19/h1-6,11H,7-10H2,(H,21,24) |
| InChIKey | XEYPNJLSYMZHKC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide?
The IUPAC name of 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide (CID 20787689) is 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide.
What is the SMILES notation for 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide?
The canonical SMILES for 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide is S=C(Nc1ccc(Cl)cc1Cl)N1CCN(c2ccccc2Cl)CC1.
What is the InChIKey of 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide?
The InChIKey is XEYPNJLSYMZHKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl3N3S/c18-12-5-6-15(14(20)11-12)21-17(24)23-9-7-22(8-10-23)16-4-2-1-3-13(16)19/h1-6,11H,7-10H2,(H,21,24).
What are the key properties of 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide?
4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide has a molecular weight of 400.76 g/mol, XLogP of 5.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenyl)-N-(2,4-dichlorophenyl)piperazine-1-carbothioamide is sourced from PubChem (CID 20787689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).