C14H20ClN3S — CID 8626833
4-(2-chlorophenyl)-N-propan-2-ylpiperazine-1-carbothioamide (PubChem CID 8626833) has the molecular formula C14H20ClN3S and a molecular weight of 297.85 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-propan-2-ylpiperazine-1-carbothioamide.
| Compound Name | 4-(2-chlorophenyl)-N-propan-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8626833 |
| Molecular Formula | C14H20ClN3S |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-(2-chlorophenyl)-N-propan-2-ylpiperazine-1-carbothioamide |
| SMILES | CC(C)NC(=S)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C14H20ClN3S/c1-11(2)16-14(19)18-9-7-17(8-10-18)13-6-4-3-5-12(13)15/h3-6,11H,7-10H2,1-2H3,(H,16,19) |
| InChIKey | QEZNKDYVSSNDIJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|