C12H16N2S — CID 115616218
N-propan-2-yl-1,3-dihydroisoindole-2-carbothioamide (PubChem CID 115616218) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N-propan-2-yl-1,3-dihydroisoindole-2-carbothioamide.
| Compound Name | N-propan-2-yl-1,3-dihydroisoindole-2-carbothioamide |
|---|---|
| PubChem CID | 115616218 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-propan-2-yl-1,3-dihydroisoindole-2-carbothioamide |
| SMILES | CC(C)NC(=S)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H16N2S/c1-9(2)13-12(15)14-7-10-5-3-4-6-11(10)8-14/h3-6,9H,7-8H2,1-2H3,(H,13,15) |
| InChIKey | WAPJSOSMQHJCRQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|