C22H24N2O2 — CID 119035210
1,4-bis(1,3-dihydroisoindol-2-yl)-2,3-dimethylbutane-1,4-dione (PubChem CID 119035210) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1,4-bis(1,3-dihydroisoindol-2-yl)-2,3-dimethylbutane-1,4-dione.
| Compound Name | 1,4-bis(1,3-dihydroisoindol-2-yl)-2,3-dimethylbutane-1,4-dione |
|---|---|
| PubChem CID | 119035210 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1,4-bis(1,3-dihydroisoindol-2-yl)-2,3-dimethylbutane-1,4-dione |
| SMILES | CC(C(=O)N1Cc2ccccc2C1)C(C)C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C22H24N2O2/c1-15(21(25)23-11-17-7-3-4-8-18(17)12-23)16(2)22(26)24-13-19-9-5-6-10-20(19)14-24/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | XCNXGEWWVONQNG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |