C11H13NO3 — CID 143478952
(2R)-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxypropan-1-one (PubChem CID 143478952) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (2R)-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxypropan-1-one.
| Compound Name | (2R)-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 143478952 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (2R)-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxypropan-1-one |
| SMILES | O=C([C@H](O)CO)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H13NO3/c13-7-10(14)11(15)12-5-8-3-1-2-4-9(8)6-12/h1-4,10,13-14H,5-7H2/t10-/m1/s1 |
| InChIKey | MSPLRGPLAWHRES-SNVBAGLBSA-N |
| XLogP | -0.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |