C12H15NO3 — CID 143154451
(2R,3S)-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxybutan-1-one (PubChem CID 143154451) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (2R,3S)-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxybutan-1-one.
| Compound Name | (2R,3S)-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxybutan-1-one |
|---|---|
| PubChem CID | 143154451 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (2R,3S)-1-(1,3-dihydroisoindol-2-yl)-2,3-dihydroxybutan-1-one |
| SMILES | C[C@H](O)[C@@H](O)C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H15NO3/c1-8(14)11(15)12(16)13-6-9-4-2-3-5-10(9)7-13/h2-5,8,11,14-15H,6-7H2,1H3/t8-,11+/m0/s1 |
| InChIKey | RELFJSYTSCQNRE-GZMMTYOYSA-N |
| XLogP | 0.27 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |