C11H13NO3 — CID 135376922
1-hydroxyethyl 1,3-dihydroisoindole-2-carboxylate (PubChem CID 135376922) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-hydroxyethyl 1,3-dihydroisoindole-2-carboxylate.
| Compound Name | 1-hydroxyethyl 1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 135376922 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1-hydroxyethyl 1,3-dihydroisoindole-2-carboxylate |
| SMILES | CC(O)OC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H13NO3/c1-8(13)15-11(14)12-6-9-4-2-3-5-10(9)7-12/h2-5,8,13H,6-7H2,1H3 |
| InChIKey | IRKNQTCNSLGXRD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|