bromo 1,3-dihydroisoindole-2-carboxylate

C9H8BrNO2 — CID 175323334

IUPACbromo 1,3-dihydroisoindole-2-carboxylate
SMILESO=C(OBr)N1Cc2ccccc2C1
InChIInChI=1S/C9H8BrNO2/c10-13-9(12)11-5-7-3-1-2-4-8(7)6-11/h1-4H,5-6H2
InChIKeyVNGLLNZCLUWPPD-UHFFFAOYSA-N
MW242.07 g/mol
LogP2.45
Rot. Bonds

About bromo 1,3-dihydroisoindole-2-carboxylate

bromo 1,3-dihydroisoindole-2-carboxylate (PubChem CID 175323334) has the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. Its IUPAC name is bromo 1,3-dihydroisoindole-2-carboxylate.

Molecular Properties

Compound Namebromo 1,3-dihydroisoindole-2-carboxylate
PubChem CID175323334
Molecular FormulaC9H8BrNO2
Molecular Weight242.07 g/mol
Exact Mass240.97
IUPAC Namebromo 1,3-dihydroisoindole-2-carboxylate
SMILESO=C(OBr)N1Cc2ccccc2C1
InChIInChI=1S/C9H8BrNO2/c10-13-9(12)11-5-7-3-1-2-4-8(7)6-11/h1-4H,5-6H2
InChIKeyVNGLLNZCLUWPPD-UHFFFAOYSA-N
XLogP2.45
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.07
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze bromo 1,3-dihydroisoindole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bromo 1,3-dihydroisoindole-2-carboxylate?
The IUPAC name of bromo 1,3-dihydroisoindole-2-carboxylate (CID 175323334) is bromo 1,3-dihydroisoindole-2-carboxylate.
What is the SMILES notation for bromo 1,3-dihydroisoindole-2-carboxylate?
The canonical SMILES for bromo 1,3-dihydroisoindole-2-carboxylate is O=C(OBr)N1Cc2ccccc2C1.
What is the InChIKey of bromo 1,3-dihydroisoindole-2-carboxylate?
The InChIKey is VNGLLNZCLUWPPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO2/c10-13-9(12)11-5-7-3-1-2-4-8(7)6-11/h1-4H,5-6H2.
What are the key properties of bromo 1,3-dihydroisoindole-2-carboxylate?
bromo 1,3-dihydroisoindole-2-carboxylate has a molecular weight of 242.07 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromo 1,3-dihydroisoindole-2-carboxylate is sourced from PubChem (CID 175323334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).