C13H16N2O — CID 138509690
N-[(E)-but-2-en-2-yl]-1,3-dihydroisoindole-2-carboxamide (PubChem CID 138509690) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-[(E)-but-2-en-2-yl]-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 138509690 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]-1,3-dihydroisoindole-2-carboxamide |
| SMILES | C/C=C(\C)NC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H16N2O/c1-3-10(2)14-13(16)15-8-11-6-4-5-7-12(11)9-15/h3-7H,8-9H2,1-2H3,(H,14,16)/b10-3+ |
| InChIKey | ZDRWIZBUCGRLGM-XCVCLJGOSA-N |
| XLogP | 2.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |