C16H14N2O2 — CID 86665079
N-(4-formylphenyl)-1,3-dihydroisoindole-2-carboxamide (PubChem CID 86665079) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(4-formylphenyl)-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-(4-formylphenyl)-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 86665079 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-(4-formylphenyl)-1,3-dihydroisoindole-2-carboxamide |
| SMILES | O=Cc1ccc(NC(=O)N2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c19-11-12-5-7-15(8-6-12)17-16(20)18-9-13-3-1-2-4-14(13)10-18/h1-8,11H,9-10H2,(H,17,20) |
| InChIKey | BPGIONYHMCQKSD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|