C28H21N3O4 — CID 144544171
4-N-[4-[(4-formylbenzoyl)amino]phenyl]-1-N-phenylbenzene-1,4-dicarboxamide (PubChem CID 144544171) has the molecular formula C28H21N3O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is 4-N-[4-[(4-formylbenzoyl)amino]phenyl]-1-N-phenylbenzene-1,4-dicarboxamide.
| Compound Name | 4-N-[4-[(4-formylbenzoyl)amino]phenyl]-1-N-phenylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 144544171 |
| Molecular Formula | C28H21N3O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 4-N-[4-[(4-formylbenzoyl)amino]phenyl]-1-N-phenylbenzene-1,4-dicarboxamide |
| SMILES | O=Cc1ccc(C(=O)Nc2ccc(NC(=O)c3ccc(C(=O)Nc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H21N3O4/c32-18-19-6-8-20(9-7-19)26(33)30-24-14-16-25(17-15-24)31-28(35)22-12-10-21(11-13-22)27(34)29-23-4-2-1-3-5-23/h1-18H,(H,29,34)(H,30,33)(H,31,35) |
| InChIKey | NZJDRSUTHCCCFM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|