About 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol
3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol (PubChem CID 143557011) has the molecular formula C16H15NO5
and a molecular weight of 301.30 g/mol. Its IUPAC name is 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol.
Molecular Properties
| Compound Name | 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol |
| PubChem CID | 143557011 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol |
| SMILES | CO.O=Cc1ccc(NC(=O)c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C15H11NO4.CH4O/c17-9-10-4-6-13(7-5-10)16-14(18)11-2-1-3-12(8-11)15(19)20;1-2/h1-9H,(H,16,18)(H,19,20);2H,1H3 |
| InChIKey | NRUUEULBVFDGSO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol?
The IUPAC name of 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol (CID 143557011) is 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol.
What is the SMILES notation for 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol?
The canonical SMILES for 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol is CO.O=Cc1ccc(NC(=O)c2cccc(C(=O)O)c2)cc1.
What is the InChIKey of 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol?
The InChIKey is NRUUEULBVFDGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO4.CH4O/c17-9-10-4-6-13(7-5-10)16-14(18)11-2-1-3-12(8-11)15(19)20;1-2/h1-9H,(H,16,18)(H,19,20);2H,1H3.
What are the key properties of 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol?
3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol has a molecular weight of 301.30 g/mol, XLogP of 2.06, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-formylphenyl)carbamoyl]benzoic acid;methanol is sourced from PubChem (CID 143557011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).