About 3-formylbenzoic acid;methanol
3-formylbenzoic acid;methanol (PubChem CID 142242456) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-formylbenzoic acid;methanol.
Molecular Properties
| Compound Name | 3-formylbenzoic acid;methanol |
| PubChem CID | 142242456 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 3-formylbenzoic acid;methanol |
| SMILES | CO.O=Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O3.CH4O/c9-5-6-2-1-3-7(4-6)8(10)11;1-2/h1-5H,(H,10,11);2H,1H3 |
| InChIKey | JDCWEEAVPVPQAR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-formylbenzoic acid;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formylbenzoic acid;methanol?
The IUPAC name of 3-formylbenzoic acid;methanol (CID 142242456) is 3-formylbenzoic acid;methanol.
What is the SMILES notation for 3-formylbenzoic acid;methanol?
The canonical SMILES for 3-formylbenzoic acid;methanol is CO.O=Cc1cccc(C(=O)O)c1.
What is the InChIKey of 3-formylbenzoic acid;methanol?
The InChIKey is JDCWEEAVPVPQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O3.CH4O/c9-5-6-2-1-3-7(4-6)8(10)11;1-2/h1-5H,(H,10,11);2H,1H3.
What are the key properties of 3-formylbenzoic acid;methanol?
3-formylbenzoic acid;methanol has a molecular weight of 182.17 g/mol, XLogP of 0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formylbenzoic acid;methanol is sourced from PubChem (CID 142242456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).