About 3-formylbenzoyl iodide
3-formylbenzoyl iodide (PubChem CID 88830571) has the molecular formula C8H5IO2
and a molecular weight of 260.03 g/mol. Its IUPAC name is 3-formylbenzoyl iodide.
Molecular Properties
| Compound Name | 3-formylbenzoyl iodide |
| PubChem CID | 88830571 |
| Molecular Formula | C8H5IO2 |
| Molecular Weight | 260.03 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | 3-formylbenzoyl iodide |
| SMILES | O=Cc1cccc(C(=O)I)c1 |
| InChI | InChI=1S/C8H5IO2/c9-8(11)7-3-1-2-6(4-7)5-10/h1-5H |
| InChIKey | TWOCIKQIYWNCAK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.03 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-formylbenzoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formylbenzoyl iodide?
The IUPAC name of 3-formylbenzoyl iodide (CID 88830571) is 3-formylbenzoyl iodide.
What is the SMILES notation for 3-formylbenzoyl iodide?
The canonical SMILES for 3-formylbenzoyl iodide is O=Cc1cccc(C(=O)I)c1.
What is the InChIKey of 3-formylbenzoyl iodide?
The InChIKey is TWOCIKQIYWNCAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5IO2/c9-8(11)7-3-1-2-6(4-7)5-10/h1-5H.
What are the key properties of 3-formylbenzoyl iodide?
3-formylbenzoyl iodide has a molecular weight of 260.03 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formylbenzoyl iodide is sourced from PubChem (CID 88830571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).