C17H12O5 — CID 87548170
4-(3-formylbenzoyl)cyclohexa-2,4-diene-1,1,2-tricarbaldehyde (PubChem CID 87548170) has the molecular formula C17H12O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-(3-formylbenzoyl)cyclohexa-2,4-diene-1,1,2-tricarbaldehyde.
| Compound Name | 4-(3-formylbenzoyl)cyclohexa-2,4-diene-1,1,2-tricarbaldehyde |
|---|---|
| PubChem CID | 87548170 |
| Molecular Formula | C17H12O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-(3-formylbenzoyl)cyclohexa-2,4-diene-1,1,2-tricarbaldehyde |
| SMILES | O=CC1=CC(C(=O)c2cccc(C=O)c2)=CCC1(C=O)C=O |
| InChI | InChI=1S/C17H12O5/c18-8-12-2-1-3-13(6-12)16(22)14-4-5-17(10-20,11-21)15(7-14)9-19/h1-4,6-11H,5H2 |
| InChIKey | NRAKVGUNUWHDMS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|