C16H11FO — CID 150735803
(4-fluorophenyl)-(3-propa-1,2-dienylphenyl)methanone (PubChem CID 150735803) has the molecular formula C16H11FO and a molecular weight of 238.26 g/mol. Its IUPAC name is (4-fluorophenyl)-(3-propa-1,2-dienylphenyl)methanone.
| Compound Name | (4-fluorophenyl)-(3-propa-1,2-dienylphenyl)methanone |
|---|---|
| PubChem CID | 150735803 |
| Molecular Formula | C16H11FO |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (4-fluorophenyl)-(3-propa-1,2-dienylphenyl)methanone |
| SMILES | C=C=Cc1cccc(C(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H11FO/c1-2-4-12-5-3-6-14(11-12)16(18)13-7-9-15(17)10-8-13/h3-11H,1H2 |
| InChIKey | JSULQAZOSMWWON-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |