About adamantane;(4-fluorophenyl)-phenylmethanone
adamantane;(4-fluorophenyl)-phenylmethanone (PubChem CID 174728613) has the molecular formula C23H25FO
and a molecular weight of 336.45 g/mol. Its IUPAC name is adamantane;(4-fluorophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | adamantane;(4-fluorophenyl)-phenylmethanone |
| PubChem CID | 174728613 |
| Molecular Formula | C23H25FO |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | adamantane;(4-fluorophenyl)-phenylmethanone |
| SMILES | C1C2CC3CC1CC(C2)C3.O=C(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H9FO.C10H16/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;1-7-2-9-4-8(1)5-10(3-7)6-9/h1-9H;7-10H,1-6H2 |
| InChIKey | BFYRQUQGLOFTTI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze adamantane;(4-fluorophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;(4-fluorophenyl)-phenylmethanone?
The IUPAC name of adamantane;(4-fluorophenyl)-phenylmethanone (CID 174728613) is adamantane;(4-fluorophenyl)-phenylmethanone.
What is the SMILES notation for adamantane;(4-fluorophenyl)-phenylmethanone?
The canonical SMILES for adamantane;(4-fluorophenyl)-phenylmethanone is C1C2CC3CC1CC(C2)C3.O=C(c1ccccc1)c1ccc(F)cc1.
What is the InChIKey of adamantane;(4-fluorophenyl)-phenylmethanone?
The InChIKey is BFYRQUQGLOFTTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FO.C10H16/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;1-7-2-9-4-8(1)5-10(3-7)6-9/h1-9H;7-10H,1-6H2.
What are the key properties of adamantane;(4-fluorophenyl)-phenylmethanone?
adamantane;(4-fluorophenyl)-phenylmethanone has a molecular weight of 336.45 g/mol, XLogP of 5.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;(4-fluorophenyl)-phenylmethanone is sourced from PubChem (CID 174728613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).