About diphenylmethanone;4-fluoroaniline
diphenylmethanone;4-fluoroaniline (PubChem CID 174706224) has the molecular formula C19H16FNO
and a molecular weight of 293.34 g/mol. Its IUPAC name is diphenylmethanone;4-fluoroaniline.
Molecular Properties
| Compound Name | diphenylmethanone;4-fluoroaniline |
| PubChem CID | 174706224 |
| Molecular Formula | C19H16FNO |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | diphenylmethanone;4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C6H6FN/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-5-1-3-6(8)4-2-5/h1-10H;1-4H,8H2 |
| InChIKey | FWZYOCKRIKUPLL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;4-fluoroaniline?
The IUPAC name of diphenylmethanone;4-fluoroaniline (CID 174706224) is diphenylmethanone;4-fluoroaniline.
What is the SMILES notation for diphenylmethanone;4-fluoroaniline?
The canonical SMILES for diphenylmethanone;4-fluoroaniline is Nc1ccc(F)cc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;4-fluoroaniline?
The InChIKey is FWZYOCKRIKUPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C6H6FN/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-5-1-3-6(8)4-2-5/h1-10H;1-4H,8H2.
What are the key properties of diphenylmethanone;4-fluoroaniline?
diphenylmethanone;4-fluoroaniline has a molecular weight of 293.34 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;4-fluoroaniline is sourced from PubChem (CID 174706224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).