C25H16F2O — CID 46188813
[3,4-bis(4-fluorophenyl)phenyl]-phenylmethanone (PubChem CID 46188813) has the molecular formula C25H16F2O and a molecular weight of 370.40 g/mol. Its IUPAC name is [3,4-bis(4-fluorophenyl)phenyl]-phenylmethanone.
| Compound Name | [3,4-bis(4-fluorophenyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 46188813 |
| Molecular Formula | C25H16F2O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [3,4-bis(4-fluorophenyl)phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H16F2O/c26-21-11-6-17(7-12-21)23-15-10-20(25(28)19-4-2-1-3-5-19)16-24(23)18-8-13-22(27)14-9-18/h1-16H |
| InChIKey | ZMLIAUXOJPKSLP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |