C39H24F2O2 — CID 166451829
[7-(4-fluorobenzoyl)-9,9-diphenylfluoren-2-yl]-(4-fluorophenyl)methanone (PubChem CID 166451829) has the molecular formula C39H24F2O2 and a molecular weight of 562.62 g/mol. Its IUPAC name is [7-(4-fluorobenzoyl)-9,9-diphenylfluoren-2-yl]-(4-fluorophenyl)methanone.
| Compound Name | [7-(4-fluorobenzoyl)-9,9-diphenylfluoren-2-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 166451829 |
| Molecular Formula | C39H24F2O2 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | [7-(4-fluorobenzoyl)-9,9-diphenylfluoren-2-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(C(=O)c3ccc(F)cc3)ccc1-2 |
| InChI | InChI=1S/C39H24F2O2/c40-31-17-11-25(12-18-31)37(42)27-15-21-33-34-22-16-28(38(43)26-13-19-32(41)20-14-26)24-36(34)39(35(33)23-27,29-7-3-1-4-8-29)30-9-5-2-6-10-30/h1-24H |
| InChIKey | ZANPKTGGASLGDD-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |