C39H26O16S4 — CID 89107613
5-[7-(3,5-disulfobenzoyl)-9,9-bis(4-hydroxyphenyl)fluorene-2-carbonyl]benzene-1,3-disulfonic acid (PubChem CID 89107613) has the molecular formula C39H26O16S4 and a molecular weight of 878.89 g/mol. Its IUPAC name is 5-[7-(3,5-disulfobenzoyl)-9,9-bis(4-hydroxyphenyl)fluorene-2-carbonyl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[7-(3,5-disulfobenzoyl)-9,9-bis(4-hydroxyphenyl)fluorene-2-carbonyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 89107613 |
| Molecular Formula | C39H26O16S4 |
| Molecular Weight | 878.89 g/mol |
| Exact Mass | 878.01 |
| IUPAC Name | 5-[7-(3,5-disulfobenzoyl)-9,9-bis(4-hydroxyphenyl)fluorene-2-carbonyl]benzene-1,3-disulfonic acid |
| SMILES | O=C(c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1)c1ccc2c(c1)C(c1ccc(O)cc1)(c1ccc(O)cc1)c1cc(C(=O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3)ccc1-2 |
| InChI | InChI=1S/C39H26O16S4/c40-27-7-3-25(4-8-27)39(26-5-9-28(41)10-6-26)35-17-21(37(42)23-13-29(56(44,45)46)19-30(14-23)57(47,48)49)1-11-33(35)34-12-2-22(18-36(34)39)38(43)24-15-31(58(50,51)52)20-32(16-24)59(53,54)55/h1-20,40-41H,(H,44,45,46)(H,47,48,49)(H,50,51,52)(H,53,54,55) |
| InChIKey | FCWMXVPMLGEOMS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 292.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|