C7H7NaO8S2 — CID 175227594
sodium;3,5-disulfobenzoic acid;hydride (PubChem CID 175227594) has the molecular formula C7H7NaO8S2 and a molecular weight of 306.25 g/mol. Its IUPAC name is sodium;3,5-disulfobenzoic acid;hydride.
| Compound Name | sodium;3,5-disulfobenzoic acid;hydride |
|---|---|
| PubChem CID | 175227594 |
| Molecular Formula | C7H7NaO8S2 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | sodium;3,5-disulfobenzoic acid;hydride |
| SMILES | O=C(O)c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C7H6O8S2.Na.H/c8-7(9)4-1-5(16(10,11)12)3-6(2-4)17(13,14)15;;/h1-3H,(H,8,9)(H,10,11,12)(H,13,14,15);;/q;+1;-1 |
| InChIKey | KJCKZNPCQIUGTO-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|