C7H5KO8S2 — CID 163417377
potassium 3,5-disulfobenzoate (PubChem CID 163417377) has the molecular formula C7H5KO8S2 and a molecular weight of 320.34 g/mol. Its IUPAC name is potassium 3,5-disulfobenzoate.
| Compound Name | potassium 3,5-disulfobenzoate |
|---|---|
| PubChem CID | 163417377 |
| Molecular Formula | C7H5KO8S2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 319.91 |
| IUPAC Name | potassium 3,5-disulfobenzoate |
| SMILES | O=C([O-])c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1.[K+] |
| InChI | InChI=1S/C7H6O8S2.K/c8-7(9)4-1-5(16(10,11)12)3-6(2-4)17(13,14)15;/h1-3H,(H,8,9)(H,10,11,12)(H,13,14,15);/q;+1/p-1 |
| InChIKey | AFOWJYKRDFTQBX-UHFFFAOYSA-M |
| XLogP | -4.45 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|