C9H8BaO6 — CID 174613622
barium(2+);benzene-1,3,5-tricarboxylic acid;hydride (PubChem CID 174613622) has the molecular formula C9H8BaO6 and a molecular weight of 349.49 g/mol. Its IUPAC name is barium(2+);benzene-1,3,5-tricarboxylic acid;hydride.
| Compound Name | barium(2+);benzene-1,3,5-tricarboxylic acid;hydride |
|---|---|
| PubChem CID | 174613622 |
| Molecular Formula | C9H8BaO6 |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | barium(2+);benzene-1,3,5-tricarboxylic acid;hydride |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/C9H6O6.Ba.2H/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;;;/h1-3H,(H,10,11)(H,12,13)(H,14,15);;;/q;+2;2*-1 |
| InChIKey | VIOZZZKNESAHJA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |