C22H16O8 — CID 175078023
benzene;5-(3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid (PubChem CID 175078023) has the molecular formula C22H16O8 and a molecular weight of 408.36 g/mol. Its IUPAC name is benzene;5-(3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid.
| Compound Name | benzene;5-(3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175078023 |
| Molecular Formula | C22H16O8 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | benzene;5-(3,5-dicarboxyphenyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2cc(C(=O)O)cc(C(=O)O)c2)c1.c1ccccc1 |
| InChI | InChI=1S/C16H10O8.C6H6/c17-13(18)9-1-7(2-10(5-9)14(19)20)8-3-11(15(21)22)6-12(4-8)16(23)24;1-2-4-6-5-3-1/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24);1-6H |
| InChIKey | DBHADWATYUVHBV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |