C15H9ClO6 — CID 53228361
5-(3-carboxy-5-chlorophenyl)benzene-1,3-dicarboxylic acid (PubChem CID 53228361) has the molecular formula C15H9ClO6 and a molecular weight of 320.68 g/mol. Its IUPAC name is 5-(3-carboxy-5-chlorophenyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(3-carboxy-5-chlorophenyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 53228361 |
| Molecular Formula | C15H9ClO6 |
| Molecular Weight | 320.68 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 5-(3-carboxy-5-chlorophenyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(Cl)cc(-c2cc(C(=O)O)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C15H9ClO6/c16-12-5-8(3-11(6-12)15(21)22)7-1-9(13(17)18)4-10(2-7)14(19)20/h1-6H,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | JRQKHUBLQVOQDW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |