About 3,5-dichlorobenzoic acid;hydrochloride
3,5-dichlorobenzoic acid;hydrochloride (PubChem CID 70357109) has the molecular formula C7H5Cl3O2
and a molecular weight of 227.47 g/mol. Its IUPAC name is 3,5-dichlorobenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3,5-dichlorobenzoic acid;hydrochloride |
| PubChem CID | 70357109 |
| Molecular Formula | C7H5Cl3O2 |
| Molecular Weight | 227.47 g/mol |
| Exact Mass | 225.94 |
| IUPAC Name | 3,5-dichlorobenzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C7H4Cl2O2.ClH/c8-5-1-4(7(10)11)2-6(9)3-5;/h1-3H,(H,10,11);1H |
| InChIKey | XEPAEGMIXXACQH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dichlorobenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichlorobenzoic acid;hydrochloride?
The IUPAC name of 3,5-dichlorobenzoic acid;hydrochloride (CID 70357109) is 3,5-dichlorobenzoic acid;hydrochloride.
What is the SMILES notation for 3,5-dichlorobenzoic acid;hydrochloride?
The canonical SMILES for 3,5-dichlorobenzoic acid;hydrochloride is Cl.O=C(O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3,5-dichlorobenzoic acid;hydrochloride?
The InChIKey is XEPAEGMIXXACQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2O2.ClH/c8-5-1-4(7(10)11)2-6(9)3-5;/h1-3H,(H,10,11);1H.
What are the key properties of 3,5-dichlorobenzoic acid;hydrochloride?
3,5-dichlorobenzoic acid;hydrochloride has a molecular weight of 227.47 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichlorobenzoic acid;hydrochloride is sourced from PubChem (CID 70357109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).