2,4-dichlorobenzoic acid

C7H4Cl2O2 — CID 5787

IUPAC2,4-dichlorobenzoic acid
SMILESO=C(O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11)
InChIKeyATCRIUVQKHMXSH-UHFFFAOYSA-N
MW191.01 g/mol
LogP2.69
Rot. Bonds1

About 2,4-dichlorobenzoic acid

2,4-dichlorobenzoic acid (PubChem CID 5787) has the molecular formula C7H4Cl2O2 and a molecular weight of 191.01 g/mol. Its IUPAC name is 2,4-dichlorobenzoic acid.

Molecular Properties

Compound Name2,4-dichlorobenzoic acid
PubChem CID5787
Molecular FormulaC7H4Cl2O2
Molecular Weight191.01 g/mol
Exact Mass189.96
IUPAC Name2,4-dichlorobenzoic acid
SMILESO=C(O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11)
InChIKeyATCRIUVQKHMXSH-UHFFFAOYSA-N
XLogP2.69
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.01
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2,4-dichlorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dichlorobenzoic acid?
The IUPAC name of 2,4-dichlorobenzoic acid (CID 5787) is 2,4-dichlorobenzoic acid.
What is the SMILES notation for 2,4-dichlorobenzoic acid?
The canonical SMILES for 2,4-dichlorobenzoic acid is O=C(O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 2,4-dichlorobenzoic acid?
The InChIKey is ATCRIUVQKHMXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11).
What are the key properties of 2,4-dichlorobenzoic acid?
2,4-dichlorobenzoic acid has a molecular weight of 191.01 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobenzoic acid is sourced from PubChem (CID 5787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).