About 2,4-dichlorobenzoic acid
2,4-dichlorobenzoic acid (PubChem CID 5787) has the molecular formula C7H4Cl2O2
and a molecular weight of 191.01 g/mol. Its IUPAC name is 2,4-dichlorobenzoic acid.
Molecular Properties
| Compound Name | 2,4-dichlorobenzoic acid |
| PubChem CID | 5787 |
| Molecular Formula | C7H4Cl2O2 |
| Molecular Weight | 191.01 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | 2,4-dichlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChIKey | ATCRIUVQKHMXSH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.01 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dichlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorobenzoic acid?
The IUPAC name of 2,4-dichlorobenzoic acid (CID 5787) is 2,4-dichlorobenzoic acid.
What is the SMILES notation for 2,4-dichlorobenzoic acid?
The canonical SMILES for 2,4-dichlorobenzoic acid is O=C(O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 2,4-dichlorobenzoic acid?
The InChIKey is ATCRIUVQKHMXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11).
What are the key properties of 2,4-dichlorobenzoic acid?
2,4-dichlorobenzoic acid has a molecular weight of 191.01 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobenzoic acid is sourced from PubChem (CID 5787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).