C7H3Cl3O2 — CID 5759
2,3,6-trichlorobenzoic acid (PubChem CID 5759) has the molecular formula C7H3Cl3O2 and a molecular weight of 225.46 g/mol. Its IUPAC name is 2,3,6-trichlorobenzoic acid.
| Compound Name | 2,3,6-trichlorobenzoic acid |
|---|---|
| PubChem CID | 5759 |
| Molecular Formula | C7H3Cl3O2 |
| Molecular Weight | 225.46 g/mol |
| Exact Mass | 223.92 |
| IUPAC Name | 2,3,6-trichlorobenzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12) |
| InChIKey | XZIDTOHMJBOSOX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|