About 2,3,6-trichlorobenzoic acid
2,3,6-trichlorobenzoic acid (PubChem CID 5759) has the molecular formula C7H3Cl3O2
and a molecular weight of 225.46 g/mol. Its IUPAC name is 2,3,6-trichlorobenzoic acid.
Molecular Properties
| Compound Name | 2,3,6-trichlorobenzoic acid |
| PubChem CID | 5759 |
| Molecular Formula | C7H3Cl3O2 |
| Molecular Weight | 225.46 g/mol |
| Exact Mass | 223.92 |
| IUPAC Name | 2,3,6-trichlorobenzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12) |
| InChIKey | XZIDTOHMJBOSOX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3,6-trichlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trichlorobenzoic acid?
The IUPAC name of 2,3,6-trichlorobenzoic acid (CID 5759) is 2,3,6-trichlorobenzoic acid.
What is the SMILES notation for 2,3,6-trichlorobenzoic acid?
The canonical SMILES for 2,3,6-trichlorobenzoic acid is O=C(O)c1c(Cl)ccc(Cl)c1Cl.
What is the InChIKey of 2,3,6-trichlorobenzoic acid?
The InChIKey is XZIDTOHMJBOSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12).
What are the key properties of 2,3,6-trichlorobenzoic acid?
2,3,6-trichlorobenzoic acid has a molecular weight of 225.46 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trichlorobenzoic acid is sourced from PubChem (CID 5759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).