About sodium;hydride;3-sulfobenzoic acid
sodium;hydride;3-sulfobenzoic acid (PubChem CID 172995778) has the molecular formula C7H7NaO5S
and a molecular weight of 226.19 g/mol. Its IUPAC name is sodium;hydride;3-sulfobenzoic acid.
Molecular Properties
| Compound Name | sodium;hydride;3-sulfobenzoic acid |
| PubChem CID | 172995778 |
| Molecular Formula | C7H7NaO5S |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | sodium;hydride;3-sulfobenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C7H6O5S.Na.H/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;;/h1-4H,(H,8,9)(H,10,11,12);;/q;+1;-1 |
| InChIKey | NCNLGZWBFJAKHC-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-sulfobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-sulfobenzoic acid?
The IUPAC name of sodium;hydride;3-sulfobenzoic acid (CID 172995778) is sodium;hydride;3-sulfobenzoic acid.
What is the SMILES notation for sodium;hydride;3-sulfobenzoic acid?
The canonical SMILES for sodium;hydride;3-sulfobenzoic acid is O=C(O)c1cccc(S(=O)(=O)O)c1.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-sulfobenzoic acid?
The InChIKey is NCNLGZWBFJAKHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5S.Na.H/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;;/h1-4H,(H,8,9)(H,10,11,12);;/q;+1;-1.
What are the key properties of sodium;hydride;3-sulfobenzoic acid?
sodium;hydride;3-sulfobenzoic acid has a molecular weight of 226.19 g/mol, XLogP of -2.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-sulfobenzoic acid is sourced from PubChem (CID 172995778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).