About sodium;3-acetylbenzenesulfonic acid;hydride
sodium;3-acetylbenzenesulfonic acid;hydride (PubChem CID 173448787) has the molecular formula C8H9NaO4S
and a molecular weight of 224.21 g/mol. Its IUPAC name is sodium;3-acetylbenzenesulfonic acid;hydride.
Molecular Properties
| Compound Name | sodium;3-acetylbenzenesulfonic acid;hydride |
| PubChem CID | 173448787 |
| Molecular Formula | C8H9NaO4S |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | sodium;3-acetylbenzenesulfonic acid;hydride |
| SMILES | CC(=O)c1cccc(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C8H8O4S.Na.H/c1-6(9)7-3-2-4-8(5-7)13(10,11)12;;/h2-5H,1H3,(H,10,11,12);;/q;+1;-1 |
| InChIKey | WKJRCUJGYQYOGU-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-acetylbenzenesulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-acetylbenzenesulfonic acid;hydride?
The IUPAC name of sodium;3-acetylbenzenesulfonic acid;hydride (CID 173448787) is sodium;3-acetylbenzenesulfonic acid;hydride.
What is the SMILES notation for sodium;3-acetylbenzenesulfonic acid;hydride?
The canonical SMILES for sodium;3-acetylbenzenesulfonic acid;hydride is CC(=O)c1cccc(S(=O)(=O)O)c1.[H-].[Na+].
What is the InChIKey of sodium;3-acetylbenzenesulfonic acid;hydride?
The InChIKey is WKJRCUJGYQYOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4S.Na.H/c1-6(9)7-3-2-4-8(5-7)13(10,11)12;;/h2-5H,1H3,(H,10,11,12);;/q;+1;-1.
What are the key properties of sodium;3-acetylbenzenesulfonic acid;hydride?
sodium;3-acetylbenzenesulfonic acid;hydride has a molecular weight of 224.21 g/mol, XLogP of -1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-acetylbenzenesulfonic acid;hydride is sourced from PubChem (CID 173448787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).