C8H9NO4S — CID 12629151
(3-acetylphenyl)sulfamic acid (PubChem CID 12629151) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is (3-acetylphenyl)sulfamic acid.
| Compound Name | (3-acetylphenyl)sulfamic acid |
|---|---|
| PubChem CID | 12629151 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (3-acetylphenyl)sulfamic acid |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H9NO4S/c1-6(10)7-3-2-4-8(5-7)9-14(11,12)13/h2-5,9H,1H3,(H,11,12,13) |
| InChIKey | MXEHNIKAPJTVHH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|