C12H15NO5S — CID 28513930
4-[(3-acetylphenyl)sulfamoyl]butanoic acid (PubChem CID 28513930) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-[(3-acetylphenyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[(3-acetylphenyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 28513930 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[(3-acetylphenyl)sulfamoyl]butanoic acid |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)CCCC(=O)O)c1 |
| InChI | InChI=1S/C12H15NO5S/c1-9(14)10-4-2-5-11(8-10)13-19(17,18)7-3-6-12(15)16/h2,4-5,8,13H,3,6-7H2,1H3,(H,15,16) |
| InChIKey | FIHAUKWQUXBWPV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |