C10H11BrINO4S — CID 114261899
4-[(3-bromo-4-iodophenyl)sulfamoyl]butanoic acid (PubChem CID 114261899) has the molecular formula C10H11BrINO4S and a molecular weight of 448.08 g/mol. Its IUPAC name is 4-[(3-bromo-4-iodophenyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[(3-bromo-4-iodophenyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 114261899 |
| Molecular Formula | C10H11BrINO4S |
| Molecular Weight | 448.08 g/mol |
| Exact Mass | 446.86 |
| IUPAC Name | 4-[(3-bromo-4-iodophenyl)sulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)Nc1ccc(I)c(Br)c1 |
| InChI | InChI=1S/C10H11BrINO4S/c11-8-6-7(3-4-9(8)12)13-18(16,17)5-1-2-10(14)15/h3-4,6,13H,1-2,5H2,(H,14,15) |
| InChIKey | RRQLAOASRMJQBH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.08 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|