C12H14N4O4S — CID 43700019
4-[[4-(triazol-2-yl)phenyl]sulfamoyl]butanoic acid (PubChem CID 43700019) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-[[4-(triazol-2-yl)phenyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[[4-(triazol-2-yl)phenyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 43700019 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-[[4-(triazol-2-yl)phenyl]sulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)Nc1ccc(-n2nccn2)cc1 |
| InChI | InChI=1S/C12H14N4O4S/c17-12(18)2-1-9-21(19,20)15-10-3-5-11(6-4-10)16-13-7-8-14-16/h3-8,15H,1-2,9H2,(H,17,18) |
| InChIKey | JFZGSVYJUMXUPP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |