C11H16N2O6S2 — CID 43715118
4-[[4-(sulfamoylmethyl)phenyl]sulfamoyl]butanoic acid (PubChem CID 43715118) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[[4-(sulfamoylmethyl)phenyl]sulfamoyl]butanoic acid.
| Compound Name | 4-[[4-(sulfamoylmethyl)phenyl]sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 43715118 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-[[4-(sulfamoylmethyl)phenyl]sulfamoyl]butanoic acid |
| SMILES | NS(=O)(=O)Cc1ccc(NS(=O)(=O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C11H16N2O6S2/c12-20(16,17)8-9-3-5-10(6-4-9)13-21(18,19)7-1-2-11(14)15/h3-6,13H,1-2,7-8H2,(H,14,15)(H2,12,16,17) |
| InChIKey | IWCNWUKCKLCGJZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |