C8H11ClN2O4S2 — CID 63666418
[4-(chloromethylsulfonylamino)phenyl]methanesulfonamide (PubChem CID 63666418) has the molecular formula C8H11ClN2O4S2 and a molecular weight of 298.77 g/mol. Its IUPAC name is [4-(chloromethylsulfonylamino)phenyl]methanesulfonamide.
| Compound Name | [4-(chloromethylsulfonylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 63666418 |
| Molecular Formula | C8H11ClN2O4S2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | [4-(chloromethylsulfonylamino)phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(NS(=O)(=O)CCl)cc1 |
| InChI | InChI=1S/C8H11ClN2O4S2/c9-6-17(14,15)11-8-3-1-7(2-4-8)5-16(10,12)13/h1-4,11H,5-6H2,(H2,10,12,13) |
| InChIKey | QZWARPILNQTIOZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|