C11H11ClN2O4S3 — CID 24650329
5-chloro-N-[4-(sulfamoylmethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 24650329) has the molecular formula C11H11ClN2O4S3 and a molecular weight of 366.87 g/mol. Its IUPAC name is 5-chloro-N-[4-(sulfamoylmethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-(sulfamoylmethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 24650329 |
| Molecular Formula | C11H11ClN2O4S3 |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 5-chloro-N-[4-(sulfamoylmethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C11H11ClN2O4S3/c12-10-5-6-11(19-10)21(17,18)14-9-3-1-8(2-4-9)7-20(13,15)16/h1-6,14H,7H2,(H2,13,15,16) |
| InChIKey | MHNZPLGELVHIAG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |