C16H19ClN2O2S2 — CID 22205412
5-chloro-N-[4-(piperidin-1-ylmethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 22205412) has the molecular formula C16H19ClN2O2S2 and a molecular weight of 370.93 g/mol. Its IUPAC name is 5-chloro-N-[4-(piperidin-1-ylmethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-(piperidin-1-ylmethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22205412 |
| Molecular Formula | C16H19ClN2O2S2 |
| Molecular Weight | 370.93 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 5-chloro-N-[4-(piperidin-1-ylmethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CN2CCCCC2)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H19ClN2O2S2/c17-15-8-9-16(22-15)23(20,21)18-14-6-4-13(5-7-14)12-19-10-2-1-3-11-19/h4-9,18H,1-3,10-12H2 |
| InChIKey | TVWJXDXKYYQLAZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |