C14H15ClN2O2S2 — CID 110361652
5-chloro-N-(3-pyrrolidin-1-ylphenyl)thiophene-2-sulfonamide (PubChem CID 110361652) has the molecular formula C14H15ClN2O2S2 and a molecular weight of 342.87 g/mol. Its IUPAC name is 5-chloro-N-(3-pyrrolidin-1-ylphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(3-pyrrolidin-1-ylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110361652 |
| Molecular Formula | C14H15ClN2O2S2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 5-chloro-N-(3-pyrrolidin-1-ylphenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(N2CCCC2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H15ClN2O2S2/c15-13-6-7-14(20-13)21(18,19)16-11-4-3-5-12(10-11)17-8-1-2-9-17/h3-7,10,16H,1-2,8-9H2 |
| InChIKey | WVIWVKAOQBKRCN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |