C15H15ClN2O3S2 — CID 7636296
5-chloro-N-[3-(2-oxopiperidin-1-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 7636296) has the molecular formula C15H15ClN2O3S2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 5-chloro-N-[3-(2-oxopiperidin-1-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(2-oxopiperidin-1-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 7636296 |
| Molecular Formula | C15H15ClN2O3S2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 5-chloro-N-[3-(2-oxopiperidin-1-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=C1CCCCN1c1cccc(NS(=O)(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C15H15ClN2O3S2/c16-13-7-8-15(22-13)23(20,21)17-11-4-3-5-12(10-11)18-9-2-1-6-14(18)19/h3-5,7-8,10,17H,1-2,6,9H2 |
| InChIKey | GYIZZUMNGKAHMC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |