C16H14Cl2N2O3S — CID 8841870
2,3-dichloro-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 8841870) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is 2,3-dichloro-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8841870 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2,3-dichloro-N-[3-(2-oxopyrrolidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1CCCN1c1cccc(NS(=O)(=O)c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c17-13-6-2-7-14(16(13)18)24(22,23)19-11-4-1-5-12(10-11)20-9-3-8-15(20)21/h1-2,4-7,10,19H,3,8-9H2 |
| InChIKey | FNTKJIYYAZARLZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |