C17H17ClN2O3S — CID 7636285
4-chloro-N-[3-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide (PubChem CID 7636285) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is 4-chloro-N-[3-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7636285 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 4-chloro-N-[3-(2-oxopiperidin-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1CCCCN1c1cccc(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H17ClN2O3S/c18-13-7-9-16(10-8-13)24(22,23)19-14-4-3-5-15(12-14)20-11-2-1-6-17(20)21/h3-5,7-10,12,19H,1-2,6,11H2 |
| InChIKey | PUBQZRDLTSEPEM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |