C17H15F3N2O3S — CID 8841908
N-[3-(2-oxopyrrolidin-1-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 8841908) has the molecular formula C17H15F3N2O3S and a molecular weight of 384.38 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8841908 |
| Molecular Formula | C17H15F3N2O3S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C1CCCN1c1cccc(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H15F3N2O3S/c18-17(19,20)12-6-8-15(9-7-12)26(24,25)21-13-3-1-4-14(11-13)22-10-2-5-16(22)23/h1,3-4,6-9,11,21H,2,5,10H2 |
| InChIKey | XGPAAWSUJHZACY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |