C19H16F3N3O3 — CID 121054613
N-[3-(2-oxopyrrolidin-1-yl)phenyl]-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 121054613) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)phenyl]-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)phenyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 121054613 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)phenyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N3O3/c20-19(21,22)12-4-1-5-13(10-12)23-17(27)18(28)24-14-6-2-7-15(11-14)25-9-3-8-16(25)26/h1-2,4-7,10-11H,3,8-9H2,(H,23,27)(H,24,28) |
| InChIKey | JCVCAGRZCJZHRP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|