C18H15F2N3O3 — CID 30679468
N'-(2,5-difluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]oxamide (PubChem CID 30679468) has the molecular formula C18H15F2N3O3 and a molecular weight of 359.33 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 30679468 |
| Molecular Formula | C18H15F2N3O3 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
| SMILES | O=C(Nc1cccc(N2CCCC2=O)c1)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H15F2N3O3/c19-11-6-7-14(20)15(9-11)22-18(26)17(25)21-12-3-1-4-13(10-12)23-8-2-5-16(23)24/h1,3-4,6-7,9-10H,2,5,8H2,(H,21,25)(H,22,26) |
| InChIKey | PEZYYWDHYRMDPH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|