C19H18ClN3O4 — CID 44901687
N'-(5-chloro-2-methoxyphenyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]oxamide (PubChem CID 44901687) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]oxamide.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 44901687 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N-[3-(2-oxopyrrolidin-1-yl)phenyl]oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C19H18ClN3O4/c1-27-16-8-7-12(20)10-15(16)22-19(26)18(25)21-13-4-2-5-14(11-13)23-9-3-6-17(23)24/h2,4-5,7-8,10-11H,3,6,9H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | JQKWJXYHSMINTO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|